12365-92-3 Usage
General Description
4,7-Dichloroquinolinium tribromide is a chemical compound with the molecular formula of C9H5Br3Cl2N. It is a quinolinium salt that is often used as a powerful oxidizing agent in organic synthesis. It is a red-brown crystalline compound that is soluble in polar solvents such as water and alcohol. 4,7-Dichloroquinolinium tribromide is commonly used as a reagent in the synthesis of various organic compounds and has been found to be effective in the oxidation of alcohols to aldehydes or ketones. Additionally, it is also known for its ability to oxidize various functional groups such as sulfides, thiols, and amines. Overall, 4,7-Dichloroquinolinium tribromide serves as a valuable tool in the field of organic chemistry due to its strong oxidizing properties and its versatile applications in various synthesis reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 12365-92-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,2,3,6 and 5 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 12365-92:
(7*1)+(6*2)+(5*3)+(4*6)+(3*5)+(2*9)+(1*2)=93
93 % 10 = 3
So 12365-92-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H5Cl2N.Br2.BrH/c10-6-1-2-7-8(11)3-4-12-9(7)5-6;1-2;/h1-5H;;1H