12372-57-5 Usage
Uses
Used in Catalyst Production:
Zirconium nitrate is used as a precursor for the production of zirconium-based catalysts, which are essential in various chemical reactions to increase efficiency and selectivity.
Used in Ceramics Industry:
In the ceramics industry, zirconium nitrate is utilized as a starting material for the synthesis of advanced ceramic materials, known for their high strength, toughness, and thermal stability.
Used in Metal-Organic Frameworks (MOFs) Production:
Zirconium nitrate serves as a building block for the creation of metal-organic frameworks, which are porous materials with applications in gas storage, separation, and catalysis.
Used in Specialty Glass Production:
Zirconium nitrate is used in the formulation of specialty glasses, which are characterized by unique optical, mechanical, and chemical properties, making them suitable for high-tech applications.
Used as a Reagent in Chemical Processes:
In various chemical processes, zirconium nitrate is employed as a reagent, facilitating specific reactions and contributing to the synthesis of desired products.
Used in Nuclear Industry:
In the nuclear industry, zirconium nitrate is used for the production of nuclear fuels, contributing to the generation of energy in nuclear power plants. Additionally, it functions as a corrosion inhibitor in nuclear reactors, enhancing the longevity and safety of these facilities.
Check Digit Verification of cas no
The CAS Registry Mumber 12372-57-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,2,3,7 and 2 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 12372-57:
(7*1)+(6*2)+(5*3)+(4*7)+(3*2)+(2*5)+(1*7)=85
85 % 10 = 5
So 12372-57-5 is a valid CAS Registry Number.
InChI:InChI=1/NO3.Zr/c2-1(3)4;/q-1;+4
