123772-40-7 Usage
Description
(2,6-DIMETHYLIMIDAZO[2,1-B][1,3]THIAZOL-5-YL)METHANOL is a chemical compound characterized by a 2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl group attached to a methanol molecule. This unique molecular structure endows it with potential applications in various fields, including pharmaceuticals, agrochemicals, and materials science, as a building block for the synthesis of bioactive compounds and functional materials.
Uses
Used in Pharmaceutical Industry:
(2,6-DIMETHYLIMIDAZO[2,1-B][1,3]THIAZOL-5-YL)METHANOL is used as a building block for the synthesis of bioactive compounds, which can be further developed into potential pharmaceutical agents for treating various diseases and conditions.
Used in Agrochemical Industry:
(2,6-DIMETHYLIMIDAZO[2,1-B][1,3]THIAZOL-5-YL)METHANOL is used as a precursor in the development of agrochemicals, such as pesticides and herbicides, due to its potential to form bioactive compounds with pesticidal or herbicidal properties.
Used in Materials Science:
(2,6-DIMETHYLIMIDAZO[2,1-B][1,3]THIAZOL-5-YL)METHANOL is used as a component in the synthesis of functional materials, which can be utilized in various applications such as sensors, catalysts, or advanced materials with specific properties.
The specific properties and potential uses of (2,6-DIMETHYLIMIDAZO[2,1-B][1,3]THIAZOL-5-YL)METHANOL would depend on further research and development in these fields.
Check Digit Verification of cas no
The CAS Registry Mumber 123772-40-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,3,7,7 and 2 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 123772-40:
(8*1)+(7*2)+(6*3)+(5*7)+(4*7)+(3*2)+(2*4)+(1*0)=117
117 % 10 = 7
So 123772-40-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2OS/c1-5-3-10-7(4-11)6(2)9-8(10)12-5/h3,11H,4H2,1-2H3
123772-40-7Relevant articles and documents
Imidazothiazole Carbamates and Acylureas as Potential Insect Control Agents
Andreani, Aldo,Rambaldi, Mirella,Carloni, Patricia,Greci, Lucedio,Stipa, Pierluigi
, p. 525 - 529 (2007/10/02)
Imidazothiazole carbamates and acylureas were prepared by reaction of 5-hydroxymethylimidazothiazole and imidazothiazole-5-carboxyamide with arylisocyanates.The products formed depend from the substituent bonded at the 6 position of t
