123776-59-0 Usage
Classification
Long-chain aliphatic amine
A compound containing a 13-carbon chain and two N,N-dimethyl substituents.
Usage
Intermediate in chemical synthesis
Primarily used to synthesize various chemical compounds, such as surfactants and antistatic agents.
Applications
Pharmaceuticals, cosmetics, and industrial products
Potential applications in the manufacturing of these diverse products.
(13Z)Configuration
Geometry of the double bond
The specific arrangement of the double bond in the carbon chain, affecting its chemical properties and interactions.
Check Digit Verification of cas no
The CAS Registry Mumber 123776-59-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,3,7,7 and 6 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 123776-59:
(8*1)+(7*2)+(6*3)+(5*7)+(4*7)+(3*6)+(2*5)+(1*9)=140
140 % 10 = 0
So 123776-59-0 is a valid CAS Registry Number.
InChI:InChI=1/C24H49N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25(2)3/h11-12H,4-10,13-24H2,1-3H3/b12-11-
