123987-12-2 Usage
Uses
Used in Pharmaceutical Industry:
[2-(4-Methylpiperazin-1-yl)phenyl]methanol is used as a building block in the synthesis of new drug candidates for its potential pharmacological properties. The molecule's structural features, such as the methyl group on the piperazine ring and the hydroxyl group on the phenyl ring, allow for further derivatization and modification to explore its biological activity, making it a valuable component in the development of novel therapeutic agents.
Used in Medicinal Chemistry Research:
[2-(4-Methylpiperazin-1-yl)phenyl]methanol is used as a research compound to study its potential pharmacological properties and to understand how its structural features contribute to its biological activity. This knowledge can inform the design of new drug candidates with improved efficacy and selectivity, advancing the field of medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 123987-12-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,3,9,8 and 7 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 123987-12:
(8*1)+(7*2)+(6*3)+(5*9)+(4*8)+(3*7)+(2*1)+(1*2)=142
142 % 10 = 2
So 123987-12-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H18N2O/c1-13-6-8-14(9-7-13)12-5-3-2-4-11(12)10-15/h2-5,15H,6-10H2,1H3/p+1
