124069-07-4 Usage
General Description
2,6-Bis(4-bromophenyl)-3-phenyl-4-piperidinamine is a chemical compound used as a building block for the synthesis of various pharmaceuticals and organic compounds. It belongs to the group of piperidine derivatives and is known for its potential biological activities. 2,6-Bis(4-bromophenyl)-3-phenyl-4-piperidinamine has been studied for its potential in the treatment of various medical conditions and diseases. It is considered to be a potent and selective inhibitor for certain biological processes and has shown promising results in preclinical studies. However, further research and studies are needed to fully understand its potential applications and mechanisms of action.
Check Digit Verification of cas no
The CAS Registry Mumber 124069-07-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,4,0,6 and 9 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 124069-07:
(8*1)+(7*2)+(6*4)+(5*0)+(4*6)+(3*9)+(2*0)+(1*7)=104
104 % 10 = 4
So 124069-07-4 is a valid CAS Registry Number.
InChI:InChI=1/C23H20Br2N2O/c24-18-10-6-15(7-11-18)20-14-21(27-28)22(16-4-2-1-3-5-16)23(26-20)17-8-12-19(25)13-9-17/h1-13,20,22-23,26,28H,14H2/b27-21+