124276-87-5 Usage
Uses
Used in Pharmaceutical Industry:
1-(2-BROMO-PHENYL)-CYCLOPROPANECARBOXYLIC ACID is used as an intermediate in the synthesis of various pharmaceutical compounds due to its unique structural features and reactivity. Its presence in the molecular structure of drugs can contribute to their therapeutic effects and properties.
Used in Organic Synthesis:
In the field of organic synthesis, 1-(2-BROMO-PHENYL)-CYCLOPROPANECARBOXYLIC ACID serves as a valuable building block for the creation of more complex organic molecules. Its cyclopropane ring and bromo-phenyl group can be further modified or used as starting points for the synthesis of a wide range of organic compounds.
Used in Medicinal Chemistry Research:
1-(2-BROMO-PHENYL)-CYCLOPROPANECARBOXYLIC ACID is used as a subject of interest in medicinal chemistry research for its potential anti-cancer and anti-inflammatory properties. Its unique structure and biological activities make it a promising candidate for the development of new drugs and therapeutic agents.
Used in Drug Development:
In the development of new drugs, 1-(2-BROMO-PHENYL)-CYCLOPROPANECARBOXYLIC ACID is utilized for its potential to contribute to the therapeutic effects of pharmaceutical compounds. Its structural features and biological activities can be harnessed to design and synthesize novel drug candidates with improved efficacy and selectivity in treating various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 124276-87-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,4,2,7 and 6 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 124276-87:
(8*1)+(7*2)+(6*4)+(5*2)+(4*7)+(3*6)+(2*8)+(1*7)=125
125 % 10 = 5
So 124276-87-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H9BrO2/c11-8-4-2-1-3-7(8)10(5-6-10)9(12)13/h1-4H,5-6H2,(H,12,13)
