124325-93-5 Usage
Pyrroloquinoline core
The molecule has a core structure consisting of a fusion of a pyrrole and a quinoline ring, which contributes to its potential biological activity and stability.
Bromine atom
The presence of a bromine atom at the 8-position of the molecule may influence its lipophilicity, metabolic properties, and potential pharmacological activity.
Hydroxyl group
The 4-position hydroxyl group can participate in hydrogen bonding and may contribute to the molecule's solubility, stability, and potential interactions with biological targets.
Methyl ester
The methyl ester functional group at the 2-position may affect the molecule's lipophilicity, metabolic properties, and potential pharmacological activity.
Indolyl group
The presence of a 5,6,7-trimethoxy-1H-indol-2-yl group at the 6-position may contribute to the molecule's biological activity, as indole-based compounds are known to have various pharmacological effects.
Stereochemistry (2R,8S)
The stereochemistry of the molecule is specified as (2R,8S), which means that the carbon atoms at positions 2 and 8 have specific spatial arrangements. This can significantly impact the molecule's biological activity and selectivity, as the spatial arrangement of atoms can determine how the molecule interacts with biological targets.
Hexahydro structure
The molecule is hexahydro, meaning it contains six hydrogen atoms within its structure. This may influence its solubility, stability, and potential pharmacological activity.
Potential pharmaceutical uses
Due to its unique structure and functional groups, 1H-Pyrrolo3,2-fquinoline-2-carboxylic acid, 8-bromo-2,3,6,7,8,9-hexahydro-4-hydroxy-2-methyl-1-oxo-6-(5,6,7-trimethoxy-1H-indol-2-yl)carbonyl-, methyl ester, (2R,8S)may have potential pharmaceutical applications. However, further research and analysis are necessary to determine its specific properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 124325-93-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,4,3,2 and 5 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 124325-93:
(8*1)+(7*2)+(6*4)+(5*3)+(4*2)+(3*5)+(2*9)+(1*3)=105
105 % 10 = 5
So 124325-93-5 is a valid CAS Registry Number.
InChI:InChI=1/C26H26BrN3O8/c1-10-13(27)8-12-15(9-16(31)20-18(12)22(32)21(29-20)26(34)38-5)30(10)25(33)14-6-11-7-17(35-2)23(36-3)24(37-4)19(11)28-14/h6-7,9-10,13,21,28-29,31H,8H2,1-5H3/t10-,13+,21-/m1/s1
124325-93-5Relevant articles and documents
Duocarmycins, potent antitumor antibiotics produced by Streptomyces sp. structures and chemistry
Yasuzawa,Murol,Ichimura,Takahashi,Ogawa,Takahashi,Sano,Saitoh
, p. 378 - 391 (2007/10/02)
Seven novel potent antitumor antibiotics, duocarmycins A (1), C1 (2), C2 (3), D (4), B1 (5), B2 (6) and SA (7), were isolated from three independently collected Streptomyces sp. The complete structures, including absolute stereochemistry, were determined by spectral and chemical studies of those duocarmycins and several derivatives. Duocarmycins A (1) and SA (7) possess a 1,2,7,7a-tetrahydrocycloprop[1,2-c]indol-4-one subunit, a common pharmacophore with that of CC-1065 (10) found from Streptomyces zelensis.