1243472-33-4 Usage
Uses
Used in Pharmaceutical Industry:
1H-Indazole, 6-bromo-3-chloro-1-methylis used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structural features, including the bromine, chlorine, and methyl substitutions, can enhance the compound's solubility, stability, and reactivity, which are crucial factors in drug development. 1H-Indazole, 6-bromo-3-chloro-1-methyl-'s potential biological activity, possibly altered due to these substitutions, makes it an interesting candidate for further research and the development of new drugs with improved therapeutic properties.
Used in Agrochemical Industry:
1H-Indazole, 6-bromo-3-chloro-1-methylis used as a building block for the synthesis of agrochemicals, such as pesticides and herbicides. 1H-Indazole, 6-bromo-3-chloro-1-methyl-'s structural modifications can contribute to the development of more effective and targeted agrochemicals with reduced environmental impact. 1H-Indazole, 6-bromo-3-chloro-1-methyl-'s potential biological activity, which may be influenced by the bromine, chlorine, and methyl substitutions, can be harnessed to create novel agrochemicals with improved performance and selectivity.
Check Digit Verification of cas no
The CAS Registry Mumber 1243472-33-4 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,2,4,3,4,7 and 2 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 1243472-33:
(9*1)+(8*2)+(7*4)+(6*3)+(5*4)+(4*7)+(3*2)+(2*3)+(1*3)=134
134 % 10 = 4
So 1243472-33-4 is a valid CAS Registry Number.
InChI:InChI=1S/C8H6BrClN2/c1-12-7-4-5(9)2-3-6(7)8(10)11-12/h2-4H,1H3
