124405-67-0 Usage
Uses
Used in Pharmaceutical Industry:
Pyrimidine, 2-bromo-5-chloro-, is used as a pharmaceutical intermediate for the synthesis of various therapeutic agents. Its unique chemical properties allow for the development of new drugs with improved efficacy and selectivity.
Used in Agriculture:
In the agricultural industry, Pyrimidine, 2-bromo-5-chloro-, is used as a precursor in the synthesis of agrochemicals, such as herbicides and pesticides. Its halogenated nature contributes to the effectiveness of these compounds in controlling pests and weeds.
Used in Material Science:
Pyrimidine, 2-bromo-5-chloro-, is utilized in material science for the development of novel materials with specific properties. Its unique structure and reactivity make it a valuable component in the synthesis of advanced materials for various applications, such as sensors, catalysts, and electronic devices.
Used as a Precursor in Organic Synthesis:
Pyrimidine, 2-bromo-5-chloro-, serves as a versatile precursor in the synthesis of other complex organic compounds. Its presence of both bromine and chlorine atoms allows for further functionalization and modification, enabling the creation of a wide range of molecules with diverse applications in research and industry.
Check Digit Verification of cas no
The CAS Registry Mumber 124405-67-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,4,4,0 and 5 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 124405-67:
(8*1)+(7*2)+(6*4)+(5*4)+(4*0)+(3*5)+(2*6)+(1*7)=100
100 % 10 = 0
So 124405-67-0 is a valid CAS Registry Number.
InChI:InChI=1/C4H2BrClN2/c5-4-7-1-3(6)2-8-4/h1-2H
