124405-67-0 Usage
General Description
Pyrimidine, 2-bromo-5-chloro- is a chemical compound with the molecular formula C4H2BrClN2. It is a halogenated derivative of pyrimidine, which is a heterocyclic aromatic compound commonly found in nucleic acids such as DNA and RNA. The 2-bromo-5-chloro- substitution on the pyrimidine ring gives this compound unique chemical properties that make it useful in various applications, including pharmaceuticals, agriculture, and material science. The presence of both bromine and chlorine in the molecule also makes it a potential precursor or intermediate in the synthesis of other complex organic compounds. Overall, Pyrimidine, 2-bromo-5-chloro- is a versatile chemical with potential utility in diverse fields of research and industry.
Check Digit Verification of cas no
The CAS Registry Mumber 124405-67-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,4,4,0 and 5 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 124405-67:
(8*1)+(7*2)+(6*4)+(5*4)+(4*0)+(3*5)+(2*6)+(1*7)=100
100 % 10 = 0
So 124405-67-0 is a valid CAS Registry Number.
InChI:InChI=1/C4H2BrClN2/c5-4-7-1-3(6)2-8-4/h1-2H
