124458-27-1 Usage
General Description
2-METHYL-4,5,6,7-TETRAHYDRO-THIAZOLO[5,4-C]PYRIDINE is a chemical compound with a thiazole ring and a pyridine ring. It is a heterocyclic compound that can be found in certain pharmaceuticals and agrochemicals. 2-METHYL-4,5,6,7-TETRAHYDRO-THIAZOLO[5,4-C]PYRIDINE is known for its potential therapeutic applications, such as acting as an anti-inflammatory and analgesic agent. It also has pesticidal properties, making it useful in agricultural applications. Its unique structure and properties make it a valuable compound in the field of medicinal and agricultural chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 124458-27-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,4,4,5 and 8 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 124458-27:
(8*1)+(7*2)+(6*4)+(5*4)+(4*5)+(3*8)+(2*2)+(1*7)=121
121 % 10 = 1
So 124458-27-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2S/c1-5-9-6-2-3-8-4-7(6)10-5/h8H,2-4H2,1H3