124522-09-4 Usage
Uses
Used in Pharmaceutical Industry:
3-BROMOMETHYL-7-METHOXY-1,4-BENZOXAZIN-2-ONE is used as a pharmaceutical candidate for its potential biological activities, including antimicrobial, antifungal, and herbicidal properties. Its unique structure and properties make it a promising compound for the development of new drugs.
Used in Organic Synthesis:
3-BROMOMETHYL-7-METHOXY-1,4-BENZOXAZIN-2-ONE is used as a key intermediate in the synthesis of various organic compounds. Its bromomethyl and methoxy groups provide opportunities for further chemical reactions and modifications, making it a valuable building block in organic chemistry.
Used in Agriculture:
3-BROMOMETHYL-7-METHOXY-1,4-BENZOXAZIN-2-ONE is used as a herbicide due to its herbicidal properties. It can help control the growth of unwanted plants and improve crop yields by reducing competition for resources.
Used in Antimicrobial Applications:
3-BROMOMETHYL-7-METHOXY-1,4-BENZOXAZIN-2-ONE is used as an antimicrobial agent, particularly against various types of bacteria. Its ability to inhibit bacterial growth makes it a potential candidate for use in medical and healthcare settings to prevent infections and promote healing.
Used in Antifungal Applications:
3-BROMOMETHYL-7-METHOXY-1,4-BENZOXAZIN-2-ONE is used as an antifungal agent, effective against various types of fungi. Its antifungal properties can be utilized in treating fungal infections and preventing the growth of mold and mildew in various industries, such as food preservation and material protection.
Check Digit Verification of cas no
The CAS Registry Mumber 124522-09-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,4,5,2 and 2 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 124522-09:
(8*1)+(7*2)+(6*4)+(5*5)+(4*2)+(3*2)+(2*0)+(1*9)=94
94 % 10 = 4
So 124522-09-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H8BrNO3/c11-5-1-2-6-7(3-5)8(4-9(13)14)12-10(6)15/h1-3,8H,4H2,(H,12,15)(H,13,14)
