1245816-26-5 Usage
Uses
Used in Organic Synthesis:
3-methyl-1H-indazol-6-yl-6-boronic acid is used as a reagent in the Suzuki-Miyaura cross-coupling reaction, a widely employed method for carbon-carbon bond formation. This reaction is crucial for the synthesis of complex organic molecules and plays a significant role in the development of new chemical compounds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-methyl-1H-indazol-6-yl-6-boronic acid serves as a building block for the synthesis of various pharmaceuticals and bioactive molecules. Its unique structure and properties contribute to the development of new drugs and therapeutic agents, enhancing the discovery and design of novel pharmaceutical compounds.
Used in the Development of New Chemical Entities and Materials:
Due to its distinctive characteristics, 3-methyl-1H-indazol-6-yl-6-boronic acid is utilized in the creation of new chemical entities and materials. Its versatility in chemical reactions and compatibility with various molecular structures make it an essential component in the advancement of material science and chemical research.
Check Digit Verification of cas no
The CAS Registry Mumber 1245816-26-5 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,2,4,5,8,1 and 6 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1245816-26:
(9*1)+(8*2)+(7*4)+(6*5)+(5*8)+(4*1)+(3*6)+(2*2)+(1*6)=155
155 % 10 = 5
So 1245816-26-5 is a valid CAS Registry Number.
InChI:InChI=1S/C8H9BN2O2/c1-5-7-3-2-6(9(12)13)4-8(7)11-10-5/h2-4,12-13H,1H3,(H,10,11)
