124681-17-0 Usage
Molecular structure
The compound has a 2-deoxyglucose backbone linked to a tetradecanoylamino group with an ethoxycarbonyloxy linker.
Derivative of 2-deoxyglucose
It is a derivative of 2-deoxyglucose, a glucose analogue.
Potential anti-cancer agent
It is considered a potential anti-cancer agent due to its ability to inhibit glucose metabolism in cancer cells.
Protecting group
The ethoxycarbonyloxy group may be used as a protecting group for the hydroxyl function of the glucose moiety.
Medicinal chemistry applications
It may have potential applications in the field of medicinal chemistry, particularly in the development of anti-cancer drugs and carbohydrate-based therapeutics.
Physiological and pharmacological properties
The precise physiological and pharmacological properties of the compound would need to be further studied to fully understand its potential uses and effects in biological systems.
Check Digit Verification of cas no
The CAS Registry Mumber 124681-17-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,4,6,8 and 1 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 124681-17:
(8*1)+(7*2)+(6*4)+(5*6)+(4*8)+(3*1)+(2*1)+(1*7)=120
120 % 10 = 0
So 124681-17-0 is a valid CAS Registry Number.
InChI:InChI=1/C23H43NO9/c1-3-5-6-7-8-9-10-11-12-13-14-19(33-23(31)32-4-2)22(30)24-17(15-25)20(28)21(29)18(27)16-26/h15,17-21,26-29H,3-14,16H2,1-2H3,(H,24,30)/t17-,18+,19?,20+,21+/m0/s1