124735-06-4 Usage
Uses
Used in Pharmaceutical Industry:
S-acetylthiorphan is used as an enkephalinase inhibitor for its potential therapeutic applications in managing pain and inflammation. Its ability to inhibit neutral endopeptidase helps in maintaining higher levels of endogenous opioids, such as enkephalins, which play a crucial role in pain modulation and the body's natural pain relief mechanisms.
Additionally, due to its role in reducing the breakdown of water and electrolytes in the intestine, S-acetylthiorphan may also be utilized in the development of antidiarrheal medications, similar to its impurity role in Racecadotril (R070600). This application can be particularly beneficial in managing conditions that involve excessive intestinal fluid secretion and diarrhea.
Check Digit Verification of cas no
The CAS Registry Mumber 124735-06-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,4,7,3 and 5 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 124735-06:
(8*1)+(7*2)+(6*4)+(5*7)+(4*3)+(3*5)+(2*0)+(1*6)=114
114 % 10 = 4
So 124735-06-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H17NO4S/c1-10(16)20-9-12(14(19)15-8-13(17)18)7-11-5-3-2-4-6-11/h2-6,12H,7-9H2,1H3,(H,15,19)(H,17,18)
