1250439-08-7 Usage
Uses
Used in Organic Synthesis:
C6H4(PO(C6H5)2)(B(OC(CH3)2)2) serves as a crucial reagent or intermediate in organic synthesis, facilitating the creation of a wide array of complex organic molecules. Its phosphorus and boron components offer unique reactive sites that can be harnessed to form new chemical bonds and structures, thereby expanding the scope of synthetic chemistry.
Used in Materials Science:
In the realm of materials science, C6H4(PO(C6H5)2)(B(OC(CH3)2)2) is utilized for the development of novel materials with specific properties. Its incorporation into polymers, for instance, can enhance thermal stability, mechanical strength, or other desirable characteristics, making it a valuable component in the design of advanced materials for various applications.
Used in Research Applications:
C6H4(PO(C6H5)2)(B(OC(CH3)2)2) is also a key component in various research applications, where its unique properties are explored for potential uses in new technologies or scientific discoveries. Its role in catalysis, for example, might be investigated to improve reaction efficiency or selectivity in chemical processes.
Used in Pharmaceutical Development:
Given its potential to form complex molecular structures, C6H4(PO(C6H5)2)(B(OC(CH3)2)2) may be employed in the pharmaceutical industry for the development of new drugs. Its ability to create diverse chemical entities could lead to the discovery of novel therapeutic agents with improved efficacy and selectivity.
Used in Chemical Sensors:
C6H4(PO(C6H5)2)(B(OC(CH3)2)2)'s sensitivity to environmental changes or specific interactions could make it a candidate for use in chemical sensors, where it could be employed to detect the presence of certain substances or changes in conditions, such as pH or temperature.
Used in Environmental Remediation:
C6H4(PO(C6H5)2)(B(OC(CH3)2)2) may also find applications in environmental remediation, where its unique chemical properties could be leveraged to remove pollutants or neutralize hazardous substances, contributing to cleaner and safer environmental conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 1250439-08-7 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,2,5,0,4,3 and 9 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 1250439-08:
(9*1)+(8*2)+(7*5)+(6*0)+(5*4)+(4*3)+(3*9)+(2*0)+(1*8)=127
127 % 10 = 7
So 1250439-08-7 is a valid CAS Registry Number.
1250439-08-7Relevant academic research and scientific papers
Porcel, Susana,Bouhadir, Ghenwa,Saffon, Nathalie,Maron, Laurent,Bourissou, Didier
, p. 6186 - 6189 (2010)
Singlet dioxygen is readily split by phosphine-boronates under mild conditions. The initially formed phosphine peroxides spontaneously rearrange by B→O migration. The resulting peroxoboronates have been structurally characterized, and their ability to und
