125108-86-3 Usage
Molecular structure
A long molecular structure with a dodecanoate group and a benzoyl group attached to it.
Dodecanoate group
A 12-carbon chain that forms the backbone of the molecule.
Benzoyl group
A functional group attached to the dodecanoate group, consisting of a benzene ring and a carbonyl group.
Hydroxyl group
A hydroxyl (-OH) group present in the benzoyl group, which can form hydrogen bonds and participate in various chemical reactions.
Azido group
An azido (-N3) group present in the benzoyl group, which can be used for further chemical modifications and reactions.
Iodine atom
An iodine atom attached to the benzene ring in the benzoyl group, which can be involved in various chemical reactions and may affect the molecule's properties.
Amino group
An amino (-NH2) group bonded to the benzoyl group, which can participate in reactions such as acylation, alkylation, and amidation.
Potential applications
The complex chemical structure suggests that 12-((5-iodo-4-azido-2-hydroxybenzoyl)amino)dodecanoate may have potential applications in various chemical and biological processes.
Synthesis of complex molecules
The compound can be used as a starting material for the synthesis of more complex molecules for research and industrial purposes.
Chemical reactivity
The presence of multiple functional groups (hydroxyl, azido, and amino) indicates that the molecule can undergo various chemical reactions, making it versatile for different applications.
Structural diversity
The combination of a long-chain dodecanoate group with a benzoyl group containing multiple functional groups results in a structurally diverse molecule.
Research and industrial uses
Due to its unique structure and potential applications, 12-((5-iodo-4-azido-2-hydroxybenzoyl)amino)dodecanoate may be of interest to researchers and industries working with complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 125108-86-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,5,1,0 and 8 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 125108-86:
(8*1)+(7*2)+(6*5)+(5*1)+(4*0)+(3*8)+(2*8)+(1*6)=103
103 % 10 = 3
So 125108-86-3 is a valid CAS Registry Number.
InChI:InChI=1/C19H27IN4O4/c20-15-12-14(17(25)13-16(15)23-24-21)19(28)22-11-9-7-5-3-1-2-4-6-8-10-18(26)27/h12-13,25H,1-11H2,(H,22,28)(H,26,27)/i20-2