125229-60-9 Usage
Uses
Used in Organic Synthesis:
L-ASPARTIC ACID BIS-ALLYL ESTER P-TOLUENESULFONATE SALT is used as a reagent in organic synthesis for its ability to facilitate chemical reactions and improve the efficiency of the synthesis process.
Used in Polymer Chemistry:
L-ASPARTIC ACID BIS-ALLYL ESTER P-TOLUENESULFONATE SALT is used as a component in the production of polymers and resins, contributing to the development of new materials with specific properties for various applications.
Used in Catalyst Development:
L-ASPARTIC ACID BIS-ALLYL ESTER P-TOLUENESULFONATE SALT is used as a catalyst or in the development of new catalysts in organic chemistry, enhancing the speed and selectivity of chemical reactions.
Used in Pharmaceutical Industry:
L-ASPARTIC ACID BIS-ALLYL ESTER P-TOLUENESULFONATE SALT may be used in the pharmaceutical industry for the synthesis of drug compounds, given its role in organic synthesis and its potential to be integrated into complex molecular structures.
Used in Chemical Research:
L-ASPARTIC ACID BIS-ALLYL ESTER P-TOLUENESULFONATE SALT is used in chemical research to explore its properties and potential applications, contributing to the advancement of knowledge in the fields of chemistry and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 125229-60-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,5,2,2 and 9 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 125229-60:
(8*1)+(7*2)+(6*5)+(5*2)+(4*2)+(3*9)+(2*6)+(1*0)=109
109 % 10 = 9
So 125229-60-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H15NO4.C7H8O3S/c1-3-5-14-9(12)7-8(11)10(13)15-6-4-2;1-6-2-4-7(5-3-6)11(8,9)10/h3-4,8H,1-2,5-7,11H2;2-5H,1H3,(H,8,9,10)/t8-;/m0./s1
