125257-38-7 Usage
Uses
Used in Pharmaceutical Industry:
2,3-Dibromo-4-methylthiophene is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of novel drug molecules. Its unique structure allows for the creation of compounds with specific therapeutic properties, making it valuable in medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical sector, 2,3-dibromo-4-methylthiophene is utilized as a building block for the production of pesticides and other agrochemicals. Its incorporation into these compounds can enhance their effectiveness in protecting crops and managing pests.
Used in Organic Synthesis Research:
2,3-Dibromo-4-methylthiophene is also used as a research compound in organic synthesis, where it aids scientists in understanding reaction mechanisms and developing new synthetic routes to complex organic molecules. Its reactivity and structural features make it a useful tool in academic and industrial research settings.
Used in Chemical Production Processes:
2,3-DIBROMO-4-METHYLTHIOPHENE is employed in industrial processes for the large-scale production of specialty chemicals. Its versatility in synthesis allows for its use across different segments of the chemical manufacturing industry, contributing to the creation of a wide array of products.
Check Digit Verification of cas no
The CAS Registry Mumber 125257-38-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,5,2,5 and 7 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 125257-38:
(8*1)+(7*2)+(6*5)+(5*2)+(4*5)+(3*7)+(2*3)+(1*8)=117
117 % 10 = 7
So 125257-38-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H4Br2S/c1-3-2-8-5(7)4(3)6/h2H,1H3
