125310-67-0 Usage
Chemical structure
1-(deoxyguanosin-N(2)-yl)-2-aminophenanthrene is a chemical compound formed by the covalent bonding of the DNA base guanine with 2-aminophenanthrene, a polycyclic aromatic hydrocarbon.
Formation
The compound is formed when guanine, a DNA base, reacts with 2-aminophenanthrene, which is found in cigarette smoke and other combustion products.
DNA adduct
1-(deoxyguanosin-N(2)-yl)-2-aminophenanthrene is a DNA adduct, meaning it forms a covalent bond with the guanine base in DNA.
Mutation potential
As a DNA adduct, it can cause mutations in the DNA sequence, which can lead to genetic changes and potentially result in cancer.
Carcinogenicity
Research has shown that 1-(deoxyguanosin-N(2)-yl)-2-aminophenanthrene is a potent carcinogen, particularly associated with tobacco smoke-related cancers.
Cancer research
Efforts to understand the mechanism of action of this compound and develop strategies to prevent its formation are ongoing in the field of cancer research.
Health concern
Due to its carcinogenic properties and association with tobacco smoke, 1-(deoxyguanosin-N(2)-yl)-2-aminophenanthrene is a significant health concern, especially for individuals exposed to cigarette smoke or other sources of 2-aminophenanthrene.
Check Digit Verification of cas no
The CAS Registry Mumber 125310-67-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,5,3,1 and 0 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 125310-67:
(8*1)+(7*2)+(6*5)+(5*3)+(4*1)+(3*0)+(2*6)+(1*7)=90
90 % 10 = 0
So 125310-67-0 is a valid CAS Registry Number.
InChI:InChI=1/C24H22N6O4/c25-16-8-7-14-13-4-2-1-3-12(13)5-6-15(14)20(16)27-24-28-22-21(23(33)29-24)26-11-30(22)19-9-17(32)18(10-31)34-19/h1-8,11,17-19,31-32H,9-10,25H2,(H2,27,28,29,33)/t17-,18+,19+/m0/s1