125802-37-1 Usage
General Description
1-PHENYLCYCLOHEPTYLAMINE HYDROCHLORIDE is a chemical compound with the molecular formula C14H21N.HCl. It is a psychoactive and stimulant drug that belongs to the phenylethylamine and amphetamine chemical classes. 1-PHENYLCYCLOHEPTYLAMINE HYDROCHLORIDE has been researched for its potential use in treating depression, anxiety, and other mental health disorders. It acts by increasing the levels of certain neurotransmitters in the brain, such as dopamine and norepinephrine, leading to mood elevation and increased alertness. However, 1-PHENYLCYCLOHEPTYLAMINE HYDROCHLORIDE can have a range of side effects and potential for abuse, so it is not approved for medical use and is considered a controlled substance in many countries.
Check Digit Verification of cas no
The CAS Registry Mumber 125802-37-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,5,8,0 and 2 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 125802-37:
(8*1)+(7*2)+(6*5)+(5*8)+(4*0)+(3*2)+(2*3)+(1*7)=111
111 % 10 = 1
So 125802-37-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H19N.ClH/c14-13(10-6-1-2-7-11-13)12-8-4-3-5-9-12;/h3-5,8-9H,1-2,6-7,10-11,14H2;1H
