126053-15-4 Usage
General Description
4-Chloro-6,7-dihydro-5H-cyclopenta-pyridin-7-OL is a chemical compound which, like all substances, is defined by its unique and specific molecular structure. The name of the chemical gives a detailed description of its chemical makeup, indicating the presence of chlorine (chloro), a five-member cyclic compound (cyclopenta), a nitrogen-containing heterocyclic compound (pyridin), a dihydro group, and an alcohol group (OL). Currently, there isn't much information readily available on the specific physical and chemical properties, potential uses, or the toxicity of this particular compound. Chemicals with similar structures are often involved in the development of pharmaceuticals, agrochemicals, or dyes. However, to determine the exact properties and potential uses of 4-Chloro-6,7-dihydro-5H-cyclopenta-pyridin-7-OL, advanced and specific research would most likely be required.
Check Digit Verification of cas no
The CAS Registry Mumber 126053-15-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,6,0,5 and 3 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 126053-15:
(8*1)+(7*2)+(6*6)+(5*0)+(4*5)+(3*3)+(2*1)+(1*5)=94
94 % 10 = 4
So 126053-15-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H8ClNO/c9-6-3-4-10-8-5(6)1-2-7(8)11/h3-4,7,11H,1-2H2
126053-15-4Relevant articles and documents
INDOLE DERIVATIVES AS ANTICANCER AGENTS
-
Page/Page column 42, (2010/08/18)
The present invention provides compounds of formula (I), their use for the treatment of cancer as well as pharmaceutical compositions comprising said compounds of formula (I).
