126111-11-3 Usage
Uses
Used in Organic Synthesis:
METHYL (2S,4R)-4-FLUOROPROLINATE is used as a key intermediate in organic synthesis for the production of complex organic molecules. Its unique structure allows for the development of novel compounds with potential applications in various industries.
Used in Pharmaceutical Research:
In the pharmaceutical industry, METHYL (2S,4R)-4-FLUOROPROLINATE is used as a building block for the development of pharmaceutical drugs. Its unique structural and chemical properties make it a valuable component in the synthesis of new drug candidates.
Used in Agrochemical Development:
METHYL (2S,4R)-4-FLUOROPROLINATE also has potential applications in the development of agrochemicals. Its unique properties can contribute to the creation of new compounds with pesticidal or herbicidal activities, enhancing crop protection and yield.
Safety Precautions:
It is crucial to handle and use METHYL (2S,4R)-4-FLUOROPROLINATE with caution and in accordance with safety guidelines. Due to potential health and safety hazards associated with its handling and use, proper protective measures and disposal methods should be followed to minimize risks.
Check Digit Verification of cas no
The CAS Registry Mumber 126111-11-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,6,1,1 and 1 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 126111-11:
(8*1)+(7*2)+(6*6)+(5*1)+(4*1)+(3*1)+(2*1)+(1*1)=73
73 % 10 = 3
So 126111-11-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H10FNO2/c1-10-6(9)5-2-4(7)3-8-5/h4-5,8H,2-3H2,1H3/t4-,5+/m1/s1
