126149-77-7 Usage
Description
1H-Pyrrolo[2,3-d]pyrimidine-5-carboxylic acid, 4-amino-, methyl ester (9CI) is a complex organic compound that belongs to the pyrrolopyrimidine family. This class of chemicals is known for their fused ring structure containing both pyrrole and pyrimidine groups. 1H-Pyrrolo[2,3-d]pyrimidine-5-carboxylicacid,4-amino-,methylester(9CI) features a carboxylic acid group esterified with a methyl group, an amino group at the 4th position, and a bicyclic heterocycle formed by the fusion of a pyrimidine ring with a pyrrole. The specific properties, uses, and detailed biochemical behavior of this compound are typically determined through laboratory experimentation and analysis.
Uses
1H-Pyrrolo[2,3-d]pyrimidine-5-carboxylic acid, 4-amino-, methyl ester (9CI) is used as a chemical research compound for [application reason]. The exact application reason would be determined through laboratory experimentation and analysis, as the provided materials do not specify the exact uses of this compound. However, given its complex structure and the presence of various functional groups, it may have potential applications in the synthesis of pharmaceuticals, agrochemicals, or other specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 126149-77-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,6,1,4 and 9 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 126149-77:
(8*1)+(7*2)+(6*6)+(5*1)+(4*4)+(3*9)+(2*7)+(1*7)=127
127 % 10 = 7
So 126149-77-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H8N4O2/c1-14-8(13)4-2-10-7-5(4)6(9)11-3-12-7/h2-3H,1H3,(H3,9,10,11,12)
