1263280-06-3 Usage
Uses
Used in Pharmaceutical Research and Drug Discovery:
2H-Pyrrolo[2,3-b]pyridin-2-one, 5-bromo-1,3-dihydro-3,3-dimethylis used as a chemical compound in pharmaceutical research and drug discovery for its potential biological activities. Its unique structure and functional properties make it a promising candidate for the development of new drugs targeting various diseases.
Used as an Intermediate in Organic Synthesis:
In addition to its potential in drug development, 2H-Pyrrolo[2,3-b]pyridin-2-one, 5-bromo-1,3-dihydro-3,3-dimethylis also used as a valuable intermediate in the synthesis of other organic compounds. Its unique chemical structure allows for further modification and incorporation into a wide range of chemical products, expanding its applications across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 1263280-06-3 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,2,6,3,2,8 and 0 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1263280-06:
(9*1)+(8*2)+(7*6)+(6*3)+(5*2)+(4*8)+(3*0)+(2*0)+(1*6)=133
133 % 10 = 3
So 1263280-06-3 is a valid CAS Registry Number.
InChI:InChI=1S/C9H9BrN2O/c1-9(2)6-3-5(10)4-11-7(6)12-8(9)13/h3-4H,1-2H3,(H,11,12,13)
