126417-76-3 Usage
Uses
Used in Organic Chemistry:
3-Chloro-3-(4-fluorophenyl)acrylonitrile is used as a chemical intermediate for the synthesis of various organic compounds. Its unique structure, which includes a 4-fluorophenyl group, a chlorine atom, and a cyano group, allows it to participate in a range of chemical reactions, making it a valuable component in the development of new organic molecules.
Used in Pharmaceutical Industry:
3-Chloro-3-(4-fluorophenyl)acrylonitrile is used as a building block for the creation of new pharmaceutical compounds. Its reactive nature and the presence of functional groups make it a promising candidate for the development of novel drugs with potential therapeutic applications.
Used in Material Science:
3-Chloro-3-(4-fluorophenyl)acrylonitrile is used as a component in the synthesis of advanced materials, such as polymers and composites. Its chemical properties can be exploited to create materials with specific properties, such as improved strength, flexibility, or thermal stability, for use in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 126417-76-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,6,4,1 and 7 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 126417-76:
(8*1)+(7*2)+(6*6)+(5*4)+(4*1)+(3*7)+(2*7)+(1*6)=123
123 % 10 = 3
So 126417-76-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H5ClFN/c10-9(5-6-12)7-1-3-8(11)4-2-7/h1-5H/b9-5+
