126807-18-9 Usage
Uses
Used in Medicinal Chemistry:
1H-Pyrrolo[2,3-b]pyridine-2,3-dione, 3-oxime is used as a key intermediate in the synthesis of pharmaceuticals for its potential to interact with specific biological targets. Its unique structure allows for the development of drugs that can modulate various biological pathways, offering new therapeutic options for treating diseases.
Used in Drug Development:
In the pharmaceutical industry, 1H-Pyrrolo[2,3-b]pyridine-2,3-dione, 3-oxime serves as a building block for the design and synthesis of novel drug candidates. Its chemical properties and reactivity make it a valuable component in the creation of molecules with potential therapeutic effects, contributing to the advancement of medicinal chemistry and drug discovery.
Used in Research and Development:
1H-Pyrrolo[2,3-b]pyridine-2,3-dione, 3-oxime is utilized in academic and industrial research settings to explore its chemical properties, reactivity, and potential applications in various fields. Its unique structure provides a foundation for investigating new reactions and mechanisms, which could lead to the discovery of innovative compounds with practical applications in medicine and other industries.
Check Digit Verification of cas no
The CAS Registry Mumber 126807-18-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,6,8,0 and 7 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 126807-18:
(8*1)+(7*2)+(6*6)+(5*8)+(4*0)+(3*7)+(2*1)+(1*8)=129
129 % 10 = 9
So 126807-18-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H5N3O2/c11-7-5(10-12)4-2-1-3-8-6(4)9-7/h1-3,12H,(H,8,9,10,11)
