127142-69-2 Usage
Uses
Used in Pharmaceutical Industry:
2,3,4-Trichlorophenyl isothiocyanate is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its reactivity and functional groups make it a valuable component in the development of new drugs, contributing to the advancement of medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical sector, 2,3,4-Trichlorophenyl isothiocyanate serves as an intermediate for the production of pesticides and other crop protection agents. Its chemical properties allow for the creation of effective formulations that protect crops from pests and diseases.
Used in Dye Industry:
2,3,4-TRICHLOROPHENYL ISOTHIOCYANATE is also utilized as an intermediate in the manufacture of dyes, where its specific chemical structure contributes to the colorfastness and stability of the dyes produced. This application is crucial for the textile and other industries that rely on durable and vibrant colorants.
Used in Research and Development:
2,3,4-Trichlorophenyl isothiocyanate is employed in research laboratories for the development of new chemical entities and the study of reaction mechanisms. Its unique properties make it a subject of interest for scientists exploring novel applications and potential improvements in existing chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 127142-69-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,7,1,4 and 2 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 127142-69:
(8*1)+(7*2)+(6*7)+(5*1)+(4*4)+(3*2)+(2*6)+(1*9)=112
112 % 10 = 2
So 127142-69-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H2Cl3NS/c8-4-1-2-5(11-3-12)7(10)6(4)9/h1-2H
