127143-18-4 Usage
General Description
ETHYL 3-(BENZOYLAMINO)-2-OXO-6-PHENYL-2H-PYRAN-5-CARBOXYLATE is a chemical compound with a complex molecular structure that includes an ethyl ester group, a benzenecarboxamide group, and a pyran ring system. It is commonly used in organic synthesis and medicinal chemistry as a building block for creating more complex molecules with potential pharmaceutical properties. ETHYL 3-(BENZOYLAMINO)-2-OXO-6-PHENYL-2H-PYRAN-5-CARBOXYLATE may have potential applications in the development of new drugs and may also exhibit biological activity due to its unique molecular structure. However, further research is needed to fully understand its potential uses and effects.
Check Digit Verification of cas no
The CAS Registry Mumber 127143-18-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,7,1,4 and 3 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 127143-18:
(8*1)+(7*2)+(6*7)+(5*1)+(4*4)+(3*3)+(2*1)+(1*8)=104
104 % 10 = 4
So 127143-18-4 is a valid CAS Registry Number.
InChI:InChI=1/C21H17NO5/c1-2-26-20(24)16-13-17(22-19(23)15-11-7-4-8-12-15)21(25)27-18(16)14-9-5-3-6-10-14/h3-13H,2H2,1H3,(H,22,23)
127143-18-4Relevant articles and documents
Methyl 2-Benzoylamino-3-dimethylaminopropenoate in the Synthesis of Heterocyclic Systems. The Synthesis of Substituted 3-Benzoylamino-2H-pyran-2-ones
Svete, Jurij,Cadez, Zvonko,Stanovnik, Branko,Tisler, Miha
, p. 70 - 72 (1990)
5,6-Disubstituted 3-benzoylamino-2H-pyran-2-ones 3 are prepared either from 1.3-dicarbonyl compounds 1 and methyl 2-benzoyl-amino-3-dimethylaminopropenoate (2) in an one-step reaction or from ethyl 2-acyl-3-dimethylaminopropenoates 5a,b or 2-(dimethylamino)-methylene-1,3-diketones 5c,d and 5-oxo-2-phenyl-1,3-oxazole 6.