127378-77-2 Usage
General Description
AKOS B018235, also known as trityl alcohol, is a chemical compound commonly used as a protecting group for alcohols in organic synthesis. It is usually employed to prevent unwanted reactions of alcohol functional groups while other parts of the molecule are being modified. Trityl alcohol is also utilized as a pharmaceutical intermediate and resin modifier, making it an important chemical in the fields of pharmaceuticals and materials science. Additionally, it is used in the production of polymers and as a reagent in organic chemistry reactions. Overall, AKOS B018235 plays a critical role in various industrial and research applications due to its versatile and valuable properties.
Check Digit Verification of cas no
The CAS Registry Mumber 127378-77-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,7,3,7 and 8 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 127378-77:
(8*1)+(7*2)+(6*7)+(5*3)+(4*7)+(3*8)+(2*7)+(1*7)=152
152 % 10 = 2
So 127378-77-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H13NO2S2/c1-8(2)16-10-5-3-4-9(6-10)7-11-12(15)14-13(17)18-11/h3-8H,1-2H3,(H,14,15,17)/b11-7+