127448-92-4 Usage
Uses
Used in Pharmaceutical Industry:
4-(2,6-dihydroxybenzoyl)-3-formyl-5-hydroxybenzoic acid is used as a pharmaceutical compound for its anti-viral properties. The compound has been found to exhibit activity against various viruses, making it a promising candidate for the development of new antiviral drugs. Its ability to target and inhibit viral replication can lead to the creation of novel treatments for viral infections.
Used in Antiviral Research:
In the field of antiviral research, 4-(2,6-dihydroxybenzoyl)-3-formyl-5-hydroxybenzoic acid serves as a valuable compound for studying the mechanisms of viral replication and the development of resistance. Understanding how 4-(2,6-dihydroxybenzoyl)-3-formyl-5-hydroxybenzoic acid interacts with viruses can provide insights into the design of more effective antiviral therapies.
Used in Drug Delivery Systems:
Similar to gallotannin, 4-(2,6-dihydroxybenzoyl)-3-formyl-5-hydroxybenzoic acid can also be incorporated into drug delivery systems to enhance its bioavailability and therapeutic outcomes. By utilizing various organic and metallic nanoparticles as carriers, the compound can be more effectively delivered to target cells, improving its overall efficacy in treating viral infections.
Check Digit Verification of cas no
The CAS Registry Mumber 127448-92-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,7,4,4 and 8 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 127448-92:
(8*1)+(7*2)+(6*7)+(5*4)+(4*4)+(3*8)+(2*9)+(1*2)=144
144 % 10 = 4
So 127448-92-4 is a valid CAS Registry Number.
InChI:InChI=1/C15H10O7/c16-6-8-4-7(15(21)22)5-11(19)12(8)14(20)13-9(17)2-1-3-10(13)18/h1-6,17-19H,(H,21,22)
