127521-69-1 Usage
Molecular structure
The compound has a long and intricate molecular structure, which is characteristic of complex organic compounds.
Functional groups
It contains various functional groups, such as aldehyde, hydroxyl, and ether groups, which contribute to its chemical properties and reactivity.
Chiral centers
The compound has multiple chiral centers (indicated by R and S configurations), which means it can exist in different stereoisomeric forms. This can affect its biological activity and interactions with other molecules.
Cyclic polyketide derivative
It is a derivative of a cyclic polyketide, which is a class of naturally occurring compounds with diverse biological activities.
Carbon-carbon double bonds
The compound has multiple carbon-carbon double bonds (indicated by E configuration), which can influence its chemical properties and potential for further reactions.
Steric centers
The presence of several stereocenters (indicated by R and S configurations) suggests that the compound has a complex three-dimensional structure, which can be important for its biological activity and interactions with other molecules.
Acetaldehyde group
The presence of an acetaldehyde group suggests that the compound may be involved in metabolic pathways or have biological activity.
Carbohydrate moieties
The compound contains various carbohydrate moieties, which can be involved in biological processes such as cell signaling and recognition.
Biological role
2-[(2R,3R,4E,6E,9R,11R,12R,13S)-12-[(2S,3R,4S,6R)-4-dimethylamino-3-hydroxy-6-methyl-oxan-2-yl]oxy-2-ethyl-3-(hydroxymethyl)-5,9,13-trimethyl-8,16-dioxo-1-oxacyclohexadeca-4,6-dien-11-yl]acetaldehyde is likely to have a specific role in a biological system, potentially as a signaling molecule or as a precursor to other complex molecules. This means that it may play a crucial role in various biological processes and pathways.
Check Digit Verification of cas no
The CAS Registry Mumber 127521-69-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,7,5,2 and 1 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 127521-69:
(8*1)+(7*2)+(6*7)+(5*5)+(4*2)+(3*1)+(2*6)+(1*9)=121
121 % 10 = 1
So 127521-69-1 is a valid CAS Registry Number.
InChI:InChI=1/C31H51NO8/c1-8-27-24(18-34)15-19(2)9-11-26(35)21(4)16-23(13-14-33)30(20(3)10-12-28(36)39-27)40-31-29(37)25(32(6)7)17-22(5)38-31/h9,11,14-15,20-25,27,29-31,34,37H,8,10,12-13,16-18H2,1-7H3/b11-9+,19-15+/t20-,21+,22+,23-,24+,25-,27+,29+,30+,31-/m0/s1