127637-03-0 Usage
Uses
Used in Pharmaceutical Industry:
H-LYS-PHE-HIS-GLU-LYS-HIS-HIS-SER-HIS-ARG-GLY-TYR-OH is used as a potential therapeutic agent for various applications due to its unique amino acid composition and sequence. The presence of specific amino acids, such as histidine, may contribute to its binding affinity to metal ions or other biomolecules, making it a candidate for targeted drug delivery or as a component in drug formulations.
Used in Cosmetic Industry:
H-LYS-PHE-HIS-GLU-LYS-HIS-HIS-SER-HIS-ARG-GLY-TYR-OH is used as an active ingredient in cosmetic products for its potential skin-protecting and regenerative properties. The peptide's amino acid composition may contribute to the promotion of collagen synthesis, skin hydration, and protection against environmental stressors.
Used in Food Industry:
H-LYS-PHE-HIS-GLU-LYS-HIS-HIS-SER-HIS-ARG-GLY-TYR-OH is used as a functional ingredient in food products for its potential health benefits. The peptide's specific amino acid sequence may have bioactive properties, such as antioxidant or anti-inflammatory effects, which can contribute to the overall nutritional value and health-promoting properties of food products.
Used in Agricultural Industry:
H-LYS-PHE-HIS-GLU-LYS-HIS-HIS-SER-HIS-ARG-GLY-TYR-OH is used as a biostimulant or plant growth promoter in agricultural applications. The peptide's amino acid composition may enhance plant growth, stress resistance, and overall crop yield by modulating plant hormone signaling pathways or providing essential nutrients.
Check Digit Verification of cas no
The CAS Registry Mumber 127637-03-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,7,6,3 and 7 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 127637-03:
(8*1)+(7*2)+(6*7)+(5*6)+(4*3)+(3*7)+(2*0)+(1*3)=130
130 % 10 = 0
So 127637-03-0 is a valid CAS Registry Number.
InChI:InChI=1/C70H99N25O17/c71-20-6-4-11-46(73)59(101)90-50(23-39-9-2-1-3-10-39)63(105)92-51(25-41-29-76-35-82-41)65(107)89-49(18-19-58(99)100)62(104)88-48(12-5-7-21-72)61(103)91-53(27-43-31-78-37-84-43)66(108)93-54(28-44-32-79-38-85-44)67(109)95-56(34-96)68(110)94-52(26-42-30-77-36-83-42)64(106)87-47(13-8-22-80-70(74)75)60(102)81-33-57(98)86-55(69(111)112)24-40-14-16-45(97)17-15-40/h1-3,9-10,14-17,29-32,35-38,46-56,96-97H,4-8,11-13,18-28,33-34,71-73H2,(H,76,82)(H,77,83)(H,78,84)(H,79,85)(H,81,102)(H,86,98)(H,87,106)(H,88,104)(H,89,107)(H,90,101)(H,91,103)(H,92,105)(H,93,108)(H,94,110)(H,95,109)(H,99,100)(H,111,112)(H4,74,75,80)