127675-46-1 Usage
Description
3-Chloro-2,4-difluorobenzaldehyde is an organic compound characterized by its molecular structure featuring a chlorine atom at the 3rd position and two fluorine atoms at the 2nd and 4th positions on a benzene ring, with an aldehyde group attached to the carbon chain. It is a versatile intermediate in the synthesis of various chemical compounds.
Uses
Used in Organic Synthesis:
3-Chloro-2,4-difluorobenzaldehyde is used as a key intermediate for the synthesis of a wide range of organic compounds. Its unique structure allows for various chemical reactions, making it a valuable building block in the creation of complex molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, 3-chloro-2,4-difluorobenzaldehyde is utilized as a starting material for the development of new drugs. Its specific functional groups and structural features enable the design and synthesis of novel therapeutic agents with potential applications in treating various diseases.
Used in Agrochemicals:
3-Chloro-2,4-difluorobenzaldehyde is employed as a crucial component in the production of agrochemicals, such as pesticides and herbicides. Its chemical properties contribute to the development of effective and targeted solutions for agricultural needs, helping to protect crops and enhance overall yield.
Used in Dyestuff Industry:
In the dyestuff industry, 3-chloro-2,4-difluorobenzaldehyde is used as a vital intermediate for the synthesis of various dyes and pigments. Its unique molecular structure allows for the creation of a diverse range of colorants, which are essential for various applications, including textiles, plastics, and printing inks.
Check Digit Verification of cas no
The CAS Registry Mumber 127675-46-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,7,6,7 and 5 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 127675-46:
(8*1)+(7*2)+(6*7)+(5*6)+(4*7)+(3*5)+(2*4)+(1*6)=151
151 % 10 = 1
So 127675-46-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H3ClF2O/c8-6-5(9)2-1-4(3-11)7(6)10/h1-3H