127682-08-0 Usage
General Description
L-2-Furylalanine is a chemically synthesized compound that is categorized as a non-proteinogenic alpha amino acid. It is predominantly utilized in scientific research, particularly in biochemistry and genetic studies, that assess the impact of incorporating unnatural amino acids in peptides. This chemical has the molecular formula C11H13NO3, suggesting a composition of eleven carbon atoms, thirteen hydrogen atoms, one nitrogen atom, and three oxygen atoms. Its systematic name is (2S)-2-Amino-3-(furan-2-yl)propanoic acid, and it is identifiable by alternate names such as Alanine,2-furyl-, and 2-Furyl-DL-alanine. Safety information and handling procedures are commonly provided due to its potential toxicity or reactivity. However, detailed data about its physical attributes, applications, and overall biological impact remains limited, necessitating further research.
Check Digit Verification of cas no
The CAS Registry Mumber 127682-08-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,7,6,8 and 2 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 127682-08:
(8*1)+(7*2)+(6*7)+(5*6)+(4*8)+(3*2)+(2*0)+(1*8)=140
140 % 10 = 0
So 127682-08-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H9NO3/c1-5(7(9)10)8-6-3-2-4-11-6/h2-5,8H,1H3,(H,9,10)/t5-/m0/s1