128118-34-3 Usage
Description
2-amino-5-methyl-4-phenylthiophene-3-carboxamide is a chemical compound that belongs to the class of thiophene derivatives. It is characterized by the presence of an amino group, a methyl group, a phenyl group, and a carboxamide group attached to the thiophene ring. 2-amino-5-methyl-4-phenylthiophene-3-carboxamide's molecular structure endows it with the potential to exhibit various biological activities, such as interacting with biological targets and receptors. Its synthesis and properties make it a valuable compound for pharmaceutical research and drug development, with potential applications in medicinal chemistry and drug discovery for the development of new therapeutic agents for various diseases and conditions.
Uses
Used in Pharmaceutical Research and Drug Development:
2-amino-5-methyl-4-phenylthiophene-3-carboxamide is used as a research compound for exploring its potential biological activities and interactions with biological targets and receptors. Its unique molecular structure allows it to be a promising candidate for the development of new therapeutic agents.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 2-amino-5-methyl-4-phenylthiophene-3-carboxamide is used as a starting material or a building block for the synthesis of novel compounds with potential therapeutic applications. Its versatile chemical structure can be modified to create new derivatives with improved pharmacological properties.
Used in Drug Discovery:
2-amino-5-methyl-4-phenylthiophene-3-carboxamide is utilized in drug discovery efforts to identify and develop new therapeutic agents for various diseases and conditions. Its potential biological activities and interactions with biological targets make it a valuable compound for screening and optimization in the drug development process.
Further research on 2-amino-5-methyl-4-phenylthiophene-3-carboxamide may help to elucidate its potential uses and benefits in the field of medicine, leading to the development of innovative treatments and therapies for patients.
Check Digit Verification of cas no
The CAS Registry Mumber 128118-34-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,8,1,1 and 8 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 128118-34:
(8*1)+(7*2)+(6*8)+(5*1)+(4*1)+(3*8)+(2*3)+(1*4)=113
113 % 10 = 3
So 128118-34-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H12N2OS/c1-7-9(8-5-3-2-4-6-8)10(11(13)15)12(14)16-7/h2-6H,14H2,1H3,(H2,13,15)
