128249-59-2 Usage
Carbonyl chloride derivative of pyrazole
The compound is derived from pyrazole, a five-membered heterocyclic aromatic compound, by attaching a carbonyl chloride group to it. This modification enhances its reactivity and makes it suitable for various organic synthesis applications.
Reactivity
1-Ethyl-3-methyl-1H-pyrazole-5-carbonyl chloride is known for its reactivity, making it a versatile building block in organic synthesis. This property allows it to be used in the preparation of heterocyclic compounds, which are essential in the pharmaceutical and agricultural industries.
Key intermediate in pyrazole-based drugs and agrochemicals
The compound serves as an important intermediate in the production of various pyrazole-based drugs and agrochemicals. Its presence in these products makes it a crucial compound in both the pharmaceutical and agricultural industries.
Potential applications in organic reactions
The chemical structure of 1-ethyl-3-methyl-1H-pyrazole-5-carbonyl chloride has been studied for its potential applications in various organic reactions. This makes it a valuable compound for chemical research and development, as it can be used to create new and innovative products.
Check Digit Verification of cas no
The CAS Registry Mumber 128249-59-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,8,2,4 and 9 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 128249-59:
(8*1)+(7*2)+(6*8)+(5*2)+(4*4)+(3*9)+(2*5)+(1*9)=142
142 % 10 = 2
So 128249-59-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H9ClN2O/c1-3-10-6(7(8)11)4-5(2)9-10/h4H,3H2,1-2H3
