128404-76-2 Usage
Description
(Z)-3-Hydroxy-2-((phenylimino)-2-thienylmethyl)-1H-inden-1-one is a complex organic compound belonging to the benzoxazole class. It features a benzoxazole skeleton, which is a five-membered aromatic ring with oxygen and nitrogen atoms at positions 1 and 3, respectively. (Z)-3-Hydroxy-2-((phenylimino)-2-thienylmethyl)-1H-inden-1-one is recognized for its potential biological activities, such as anti-inflammatory, anti-cancer, and anti-microbial properties. Its unique chemical structure and promising medicinal properties make it a subject of interest for further research and development in medicinal chemistry.
Uses
Used in Pharmaceutical Industry:
(Z)-3-Hydroxy-2-((phenylimino)-2-thienylmethyl)-1H-inden-1-one is used as a potential therapeutic agent for various diseases and conditions due to its anti-inflammatory, anti-cancer, and anti-microbial properties. Its multifaceted biological activities make it a promising candidate for the development of new drugs to treat a range of health issues.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, (Z)-3-Hydroxy-2-((phenylimino)-2-thienylmethyl)-1H-inden-1-one serves as an interesting target for further research and development. Its unique chemical structure and potential biological activities provide a foundation for exploring new drug candidates and understanding their mechanisms of action.
Used in Drug Design and Development:
(Z)-3-Hydroxy-2-((phenylimino)-2-thienylmethyl)-1H-inden-1-one's potential biological activities and unique structure make it a valuable asset in drug design and development. Researchers can use (Z)-3-Hydroxy-2-((phenylimino)-2-thienylmethyl)-1H-inden-1-one as a starting point to create new molecules with improved properties, targeting specific diseases and conditions more effectively.
Used in Anti-Cancer Applications:
(Z)-3-Hydroxy-2-((phenylimino)-2-thienylmethyl)-1H-inden-1-one is used as a potential anti-cancer agent, given its demonstrated anti-cancer properties. It may be studied for its ability to target and inhibit cancer cell growth, making it a candidate for further research in the development of novel cancer treatments.
Used in Anti-Inflammatory Applications:
(Z)-3-Hydroxy-2-((phenylimino)-2-thienylmethyl)-1H-inden-1-one's anti-inflammatory properties make it a candidate for use in the development of treatments for inflammatory diseases. (Z)-3-Hydroxy-2-((phenylimino)-2-thienylmethyl)-1H-inden-1-one could be investigated for its potential to alleviate inflammation and reduce the severity of conditions such as arthritis, asthma, and other inflammatory disorders.
Used in Anti-Microbial Applications:
Given its anti-microbial properties, (Z)-3-Hydroxy-2-((phenylimino)-2-thienylmethyl)-1H-inden-1-one may be utilized in the development of new antimicrobial agents to combat bacterial, fungal, and other microbial infections. This could be particularly useful in the ongoing fight against antibiotic-resistant bacteria and the need for new, effective treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 128404-76-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,8,4,0 and 4 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 128404-76:
(8*1)+(7*2)+(6*8)+(5*4)+(4*0)+(3*4)+(2*7)+(1*6)=122
122 % 10 = 2
So 128404-76-2 is a valid CAS Registry Number.
InChI:InChI=1/C20H13NO2S/c22-19-14-9-4-5-10-15(14)20(23)17(19)18(16-11-6-12-24-16)21-13-7-2-1-3-8-13/h1-12,21H