128426-86-8 Usage
Description
3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid is a chemical compound characterized by the molecular formula C8H3F5O3. It is a trifluorinated benzoic acid derivative featuring a difluoromethoxy group substitution at the 3-position of the benzene ring. 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid is distinguished by its unique substitution pattern, which endows it with specific physicochemical properties and makes it a valuable asset in the fields of pharmaceutical and agrochemical research and development.
Uses
Used in Pharmaceutical Industry:
3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid serves as a building block for the synthesis of various biologically active compounds. Its unique structural features are leveraged in the development of new drugs, contributing to the advancement of medicinal chemistry by offering novel scaffolds for drug discovery and optimization.
Used in Agrochemical Industry:
Similarly, in the agrochemical sector, 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid is utilized as a key intermediate in the synthesis of agrochemicals. Its properties are harnessed to create new pesticides or herbicides, enhancing crop protection strategies and contributing to agricultural productivity.
Used in Organic Chemistry Research:
3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid is also a valuable tool for research in organic chemistry. The difluoromethoxy group provides a handle for studying structure-activity relationships, which is crucial for understanding how molecular structure influences biological activity. This knowledge is fundamental for the design of more effective and selective chemical agents.
Check Digit Verification of cas no
The CAS Registry Mumber 128426-86-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,8,4,2 and 6 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 128426-86:
(8*1)+(7*2)+(6*8)+(5*4)+(4*2)+(3*6)+(2*8)+(1*6)=138
138 % 10 = 8
So 128426-86-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H3F5O3/c9-3-1-2(7(14)15)4(10)6(5(3)11)16-8(12)13/h1,8H,(H,14,15)
