128593-72-6 Usage
Uses
Used in Pharmaceutical Industry:
(R)-N-(2-PROPYL)-1-PHENYLETHYLAMINE HYDROCHLORIDE is used as a chemical intermediate for the synthesis of various pharmaceuticals, leveraging its reactivity and structural properties to contribute to the development of new medications.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, (R)-N-(2-PROPYL)-1-PHENYLETHYLAMINE HYDROCHLORIDE is utilized as a key component in the design and synthesis of compounds targeting specific receptors in the central nervous system, potentially leading to advancements in the treatment of neurological disorders.
Used in Organic Compounds Synthesis:
(R)-N-(2-PROPYL)-1-PHENYLETHYLAMINE HYDROCHLORIDE also serves as a building block in the synthesis of diverse organic compounds, highlighting its versatility in organic chemistry and its ability to form the basis of complex molecular structures.
Check Digit Verification of cas no
The CAS Registry Mumber 128593-72-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,8,5,9 and 3 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 128593-72:
(8*1)+(7*2)+(6*8)+(5*5)+(4*9)+(3*3)+(2*7)+(1*2)=156
156 % 10 = 6
So 128593-72-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H17N/c1-9(2)12-10(3)11-7-5-4-6-8-11/h4-10,12H,1-3H3/t10-/m1/s1
