128740-18-1 Usage
Uses
Used in Pharmaceutical Industry:
1-Methyl-octahydropyrrolo[3.4-b]pyridine is used as a key intermediate in the synthesis of various pharmaceutical compounds for its ability to contribute to the development of antiviral agents, analgesics, and other drugs. Its unique structure and properties make it a valuable component in drug discovery and design.
Used in Agrochemical Industry:
In the agrochemical sector, 1-Methyl-octahydropyrrolo[3.4-b]pyridine is utilized as a building block in the creation of agrochemicals, contributing to the development of effective and targeted pest control solutions.
Used in Material Science:
1-Methyl-octahydropyrrolo[3.4-b]pyridine is employed in the development of new materials, leveraging its chemical properties to enhance material performance and create innovative solutions in various applications.
Used as a Reagent in Organic Chemistry:
1-Methyl-octahydropyrrolo[3.4-b]pyridine serves as a reagent in organic chemistry reactions, facilitating the synthesis of complex organic molecules and contributing to advancements in chemical research.
Overall, 1-Methyl-octahydropyrrolo[3.4-b]pyridine is a crucial component in various industries, particularly in the fields of pharmaceuticals and agrochemicals, due to its versatile and useful properties. Its applications extend to material science and organic chemistry, making it an essential tool in chemical research and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 128740-18-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,8,7,4 and 0 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 128740-18:
(8*1)+(7*2)+(6*8)+(5*7)+(4*4)+(3*0)+(2*1)+(1*8)=131
131 % 10 = 1
So 128740-18-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H16N2/c1-10-4-2-3-7-5-9-6-8(7)10/h7-9H,2-6H2,1H3
