129-65-7 Usage
Chemical class
Carboxylic acid
Explanation
Contains a carboxyl group (COOH) that imparts acidic properties.
Explanation
Unique molecular structure composed of fused benzene and furan rings, which are aromatic and heterocyclic organic compounds, respectively.
Explanation
The presence of multiple hydroxyl groups increases the potential for hydrogen bonding and reactivity with other molecules.
Explanation
The ketone group provides additional reactivity and the potential for further chemical modifications.
Explanation
1,3-Dihydro-4,10-dihydroxy-8-methyl-3-oxoisobenzofuro[5,4-b]benzofuran-7-carboxylic acid is a derivative of the naturally occurring compound benzo[c]phenanthrene, which is a polycyclic aromatic hydrocarbon.
Explanation
The presence of a methyl group suggests that the compound is a derivative of a larger compound, possibly found in natural sources.
Explanation
The complexity of the molecular structure indicates potential for biological or pharmacological activity, which could be useful in the development of new drugs or therapies.
Explanation
The long and complex name reflects the compound's structure, which includes various functional groups and a fused ring system.
Molecular structure
Fused benzene and furan rings
Presence of hydroxyl groups
Multiple hydroxyl (OH) groups
Presence of a ketone group
Ketone (C=O) group
Derivative of benzo[c]phenanthrene
Naturally occurring compound
Presence of a methyl group
8-methyl group
Potential for biological or pharmacological activity
Complex structure
Check Digit Verification of cas no
The CAS Registry Mumber 129-65-7 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,2 and 9 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 129-65:
(5*1)+(4*2)+(3*9)+(2*6)+(1*5)=57
57 % 10 = 7
So 129-65-7 is a valid CAS Registry Number.
InChI:InChI=1/C16H10O7/c1-5-2-7(17)13-12-6-4-22-16(21)11(6)8(18)3-9(12)23-14(13)10(5)15(19)20/h2-3,17-18H,4H2,1H3,(H,19,20)