1291-72-1 Usage
General Description
3-FERROCENOYLPROPIONIC ACID is a chemical compound with the molecular formula C15H14FeO3. It is a derivative of ferrocene, a metallocene compound with a central iron atom sandwiched between two cyclopentadienyl rings. 3-FERROCENOYLPROPIONIC ACID is a red-brown solid at room temperature and is often used as a catalyst in organic reactions. It has potential applications in the synthesis of various organic compounds and materials, as well as in the field of electrochemistry due to its unique redox properties. Additionally, it has been studied for its potential anti-inflammatory and anticancer properties, making it a subject of interest in medicinal chemistry research.
Check Digit Verification of cas no
The CAS Registry Mumber 1291-72-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,2,9 and 1 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 1291-72:
(6*1)+(5*2)+(4*9)+(3*1)+(2*7)+(1*2)=71
71 % 10 = 1
So 1291-72-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H9O3.C5H5.Fe/c10-8(5-6-9(11)12)7-3-1-2-4-7;1-2-4-5-3-1;/h1-4H,5-6H2,(H,11,12);1-5H;/rC14H14FeO3/c16-13(8-9-14(17)18)11-6-3-7-12(11)15-10-4-1-2-5-10/h1-7,10,12H,8-9H2,(H,17,18)
