1291-72-1 Usage
Uses
Used in Organic Synthesis:
3-FERROCENOYLPROPIONIC ACID is used as a catalyst in organic synthesis for its ability to facilitate various chemical reactions, enhancing the efficiency and selectivity of the processes involved.
Used in Electrochemistry:
In the field of electrochemistry, 3-FERROCENOYLPROPIONIC ACID is employed for its unique redox properties, which make it suitable for applications such as the development of electrochemical sensors and energy storage devices.
Used in Medicinal Chemistry Research:
3-FERROCENOYLPROPIONIC ACID is used as a subject of interest in medicinal chemistry research due to its potential anti-inflammatory and anticancer properties. Its study aims to explore its therapeutic potential and contribute to the development of new pharmaceutical agents.
Used in the Synthesis of Materials:
3-FERROCENOYLPROPIONIC ACID is also utilized in the synthesis of various materials, where its catalytic properties and redox behavior can be harnessed to create novel materials with specific properties for different applications.
Check Digit Verification of cas no
The CAS Registry Mumber 1291-72-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,2,9 and 1 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 1291-72:
(6*1)+(5*2)+(4*9)+(3*1)+(2*7)+(1*2)=71
71 % 10 = 1
So 1291-72-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H9O3.C5H5.Fe/c10-8(5-6-9(11)12)7-3-1-2-4-7;1-2-4-5-3-1;/h1-4H,5-6H2,(H,11,12);1-5H;/rC14H14FeO3/c16-13(8-9-14(17)18)11-6-3-7-12(11)15-10-4-1-2-5-10/h1-7,10,12H,8-9H2,(H,17,18)
