129164-39-2 Usage
Uses
Used in Pharmaceutical Industry:
3-Methyl-1-(2-phenyl)ethyl-4-piperidinone is used as a key intermediate in the synthesis of various pharmaceutical drugs due to its biological activity and structural features. Its presence in the molecular structure of these drugs can contribute to their therapeutic effects and pharmacological properties.
Used in Chemical Synthesis:
3-Methyl-1-(2-phenyl)ethyl-4-piperidinone serves as a versatile building block in the synthesis of complex organic compounds. Its unique structure, including the phenyl group, methyl group, and alkyl chain, allows for further functionalization and modification, making it a valuable component in the creation of novel chemical entities with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 129164-39-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,9,1,6 and 4 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 129164-39:
(8*1)+(7*2)+(6*9)+(5*1)+(4*6)+(3*4)+(2*3)+(1*9)=132
132 % 10 = 2
So 129164-39-2 is a valid CAS Registry Number.
InChI:InChI=1/C14H19NO/c1-12-11-15(10-8-14(12)16)9-7-13-5-3-2-4-6-13/h2-6,12H,7-11H2,1H3
