129612-52-8 Usage
General Description
The chemical compound "(2S)-N-[(1S)-1-[[(2S)-1-[(2S)-2-[[(1S)-2-carbamoyl-1-[[(1S)-1-carbamoyl-2-(1H-indol-3-yl)ethyl]carbamoyl]ethyl]carbamoyl]pyrrolidin-1-yl]-3-hydroxy-1-oxo-propan-2-yl]carbamoyl]-2-phenyl-ethyl]-2-[[(2S)-4-methyl-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanoyl]amino]butanediamide" is a complex organic compound consisting of multiple amino acids, carboxylic acids, and carbamoyl groups. It contains a pyrrolidin structure, a phenyl-ethyl group, and an indol-3-yl moiety. The chemical compound is an intricate and highly specific molecule with a long and complex molecular structure.
Check Digit Verification of cas no
The CAS Registry Mumber 129612-52-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,9,6,1 and 2 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 129612-52:
(8*1)+(7*2)+(6*9)+(5*6)+(4*1)+(3*2)+(2*5)+(1*2)=128
128 % 10 = 8
So 129612-52-8 is a valid CAS Registry Number.
InChI:InChI=1/C47H62N12O12/c1-24(2)17-31(54-41(65)29-14-15-39(63)52-29)42(66)56-33(20-37(48)61)45(69)55-32(18-25-9-4-3-5-10-25)43(67)58-35(23-60)47(71)59-16-8-13-36(59)46(70)57-34(21-38(49)62)44(68)53-30(40(50)64)19-26-22-51-28-12-7-6-11-27(26)28/h3-7,9-12,22,24,29-36,51,60H,8,13-21,23H2,1-2H3,(H2,48,61)(H2,49,62)(H2,50,64)(H,52,63)(H,53,68)(H,54,65)(H,55,69)(H,56,66)(H,57,70)(H,58,67)/t29-,30-,31-,32-,33-,34-,35-,36-/m0/s1