129679-49-8 Usage
Explanation
Different sources of media describe the Explanation of 129679-49-8 differently. You can refer to the following data:
1. The molecular formula represents the number of atoms of each element present in a molecule. In this case, the compound has 6 carbon (C), 6 hydrogen (H), and 4 oxygen (O) atoms.
2. The compound has a ring structure, which is common in organic chemistry. The two adjacent oxygen atoms are part of the ring, contributing to its unique properties.
3. This compound is not found naturally and is created through chemical synthesis, making it a synthetic compound.
4. The compound is a dihydro (two hydrogen atoms added) derivative of another compound, furo(3,4-c)furan-1,3(4H)-dione. This means that it has a similar structure but with additional hydrogen atoms.
5. The compound is utilized in different industries and is involved in the synthesis of other chemicals, making it a valuable component in the chemical industry.
6. As with many chemicals, it is essential to take safety measures when handling and using this compound. This may include wearing protective gear, working in a well-ventilated area, and following proper disposal procedures to minimize the risk of harm.
7. The chemical name provides a detailed description of the compound's structure, including the presence of a 1,4-ethano bridge and a dihydro group. This name is used to uniquely identify the compound in scientific and industrial contexts.
Structure
Cyclic with two adjacent oxygen atoms
Type
Synthetic compound
Derivative
Dihydro derivative of furo(3,4-c)furan-1,3(4H)-dione
Industrial applications
Used in various industrial applications and chemical synthesis processes
Safety precautions
Handle and use with caution due to potential hazards and risks
Check Digit Verification of cas no
The CAS Registry Mumber 129679-49-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,9,6,7 and 9 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 129679-49:
(8*1)+(7*2)+(6*9)+(5*6)+(4*7)+(3*9)+(2*4)+(1*9)=178
178 % 10 = 8
So 129679-49-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H8O4/c9-7-5-3-1-2-4(12-7)6(5)8(10)11-3/h3-6H,1-2H2
129679-49-8Relevant articles and documents
Brefeldin A derivatives
-
, (2008/06/13)
Cytotoxic Michael addition derivatives of brefeldin A are described. Oxidation of thiol addition products of brefeldin A provides the corresponding sulfoxides and sulfones. The sulfoxides exhibited more cytotoxic activity than the corresponding sulfides and sulfones in a variety of human cancer cell lines. Pharmaceutical formulations of the disclosed cytotoxic derivatives are also described.
