129679-51-2 Usage
Explanation
Different sources of media describe the Explanation of 129679-51-2 differently. You can refer to the following data:
1. The molecular formula represents the number of atoms of each element present in a molecule of the compound.
2. The compound has a cyclic structure with sulfur atoms and a combination of a tetrahydrothiophene ring (a six-membered ring with one sulfur atom and four hydrogen atoms) and a thiophenone group (a five-membered ring with one sulfur atom and a carbonyl group).
3. The compound contains three main functional groups, which are responsible for its chemical properties and reactivity.
4. Due to its unique structure and reactivity, the compound is used as an intermediate in the synthesis of various organic compounds, including pharmaceuticals and agrochemicals.
5. The compound's unique chemical structure and reactivity make it a promising candidate for further research and development in the fields of medicine and material science.
6. Chemists and researchers need to study the properties and reactions of this compound to fully understand its potential and how it can be utilized in various fields.
7. The compound's unique structure, which includes a sulfur-containing cyclic ketone and a tetrahydrothiophene ring, contributes to its reactivity and potential applications in various industries.
Structure
Cyclic sulfur-containing ketone with a tetrahydrothiophene ring and a thiophenone moiety
Functional Groups
Tetrahydrothiophene ring, Thiophenone moiety, and Carbonyl group
Applications
Organic synthesis, building block in pharmaceuticals and agrochemicals
Potential Applications
Medicine and material science
Importance for Research
Understanding properties and reactions
Reactivity
Unique chemical structure and reactivity
Check Digit Verification of cas no
The CAS Registry Mumber 129679-51-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,9,6,7 and 9 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 129679-51:
(8*1)+(7*2)+(6*9)+(5*6)+(4*7)+(3*9)+(2*5)+(1*1)=172
172 % 10 = 2
So 129679-51-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H8OS3/c9-7-5-3-1-2-4(11-7)6(5)8(10)12-3/h3-6H,1-2H2
