129679-53-4 Usage
Explanation
Different sources of media describe the Explanation of 129679-53-4 differently. You can refer to the following data:
1. The molecular formula represents the number of atoms of each element present in a molecule. In this case, the compound has 6 carbon (C), 6 hydrogen (H), 2 sulfur (S), and 2 oxygen (O) atoms.
2. Cyclic organosulfur compound
2. This compound is characterized by a cyclic structure containing sulfur atoms bonded to carbon atoms, which is typical of organosulfur compounds.
3. Fused tetrathiabenzodioxane ring system
3. The compound has a complex ring structure consisting of four sulfur atoms and two oxygen atoms, fused together to form a larger ring system.
4. Pharmaceutical intermediate
4. It is used as a starting material or building block in the synthesis of various drugs, playing a crucial role in the development of new pharmaceuticals.
5. Reagent in organic synthesis
5. The compound is also used as a reagent in organic chemistry, facilitating various chemical reactions and transformations.
6. Antibacterial and antifungal activities
6. Studies have shown that 1,4-Ethano-1H,3H-furo(3,4-c)furan-3,6(4H)-dithione, dihydrohas the potential to inhibit the growth of bacteria and fungi, making it a candidate for use in antimicrobial applications.
7. Antioxidant potential
7. The compound has demonstrated antioxidant properties, which means it can help neutralize harmful free radicals and protect cells from oxidative damage.
8. Treatment of various diseases
8. Due to its diverse biological and medicinal properties, 1,4-Ethano-1H,3H-furo(3,4-c)furan-3,6(4H)-dithione, dihydrohas the potential to be used in the treatment of a range of diseases, although further research is needed to determine its specific applications.
Check Digit Verification of cas no
The CAS Registry Mumber 129679-53-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,9,6,7 and 9 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 129679-53:
(8*1)+(7*2)+(6*9)+(5*6)+(4*7)+(3*9)+(2*5)+(1*3)=174
174 % 10 = 4
So 129679-53-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H8O2S2/c11-7-5-3-1-2-4(10-7)6(5)8(12)9-3/h3-6H,1-2H2
