130049-80-8 Usage
Uses
Used in Organic Synthesis:
3-(2-Chloroethyl)-6,7,8,9-tetrahydro-7-methoxy-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one is used as a synthetic intermediate for the development of various organic compounds. Its unique structure and functional groups make it a valuable building block in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-(2-Chloroethyl)-6,7,8,9-tetrahydro-7-methoxy-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one is used as a key component in the synthesis of potential drug candidates. Its presence in the molecular structure can contribute to the desired pharmacological properties, such as improved potency, selectivity, and bioavailability.
Used in Agrochemical Industry:
3-(2-Chloroethyl)-6,7,8,9-tetrahydro-7-methoxy-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one also finds application in the agrochemical industry, where it is used as a precursor for the synthesis of novel pesticides and herbicides. Its incorporation into these compounds can lead to enhanced efficacy and selectivity against target pests and weeds.
Used in Specialty Chemicals:
In the specialty chemicals sector, 3-(2-Chloroethyl)-6,7,8,9-tetrahydro-7-methoxy-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one is employed as a versatile intermediate for the production of various high-value chemicals. Its unique chemical properties allow it to be tailored for specific applications, such as in the synthesis of dyes, fragrances, and other functional materials.
Check Digit Verification of cas no
The CAS Registry Mumber 130049-80-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,0,0,4 and 9 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 130049-80:
(8*1)+(7*3)+(6*0)+(5*0)+(4*4)+(3*9)+(2*8)+(1*0)=88
88 % 10 = 8
So 130049-80-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H17ClN2O2/c1-8-10(5-6-13)12(16)15-7-9(17-2)3-4-11(15)14-8/h9H,3-7H2,1-2H3
