130100-08-2 Usage
General Description
1,3-Dihydro-1-(oxiranylmethyl)-3-(thiiranylmethyl)-2H-benzimidazol-2-one is a chemical compound with a complex molecular structure containing oxirane and thiirane functional groups. It is a heterocyclic compound with potential pharmaceutical applications due to its benzimidazole core, which is commonly found in drugs with various therapeutic uses. The presence of oxirane and thiirane moieties suggests potential reactivity and functionality in biological systems, and further investigation into its pharmacological properties may reveal potential benefits for drug development. Additionally, its structural features make it of interest for potential exploration in medicinal chemistry for applications in drug design and discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 130100-08-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,0,1,0 and 0 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 130100-08:
(8*1)+(7*3)+(6*0)+(5*1)+(4*0)+(3*0)+(2*0)+(1*8)=42
42 % 10 = 2
So 130100-08-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H14N2O2S/c16-13-14(5-9-7-17-9)11-3-1-2-4-12(11)15(13)6-10-8-18-10/h1-4,9-10H,5-8H2